C14H18F2N2O — CID 142327023
N-(1-ethyl-3-methylpyrrolidin-3-yl)-2,6-difluorobenzamide (PubChem CID 142327023) has the molecular formula C14H18F2N2O and a molecular weight of 268.31 g/mol. Its IUPAC name is N-(1-ethyl-3-methylpyrrolidin-3-yl)-2,6-difluorobenzamide.
| Compound Name | N-(1-ethyl-3-methylpyrrolidin-3-yl)-2,6-difluorobenzamide |
|---|---|
| PubChem CID | 142327023 |
| Molecular Formula | C14H18F2N2O |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | N-(1-ethyl-3-methylpyrrolidin-3-yl)-2,6-difluorobenzamide |
| SMILES | CCN1CCC(C)(NC(=O)c2c(F)cccc2F)C1 |
| InChI | InChI=1S/C14H18F2N2O/c1-3-18-8-7-14(2,9-18)17-13(19)12-10(15)5-4-6-11(12)16/h4-6H,3,7-9H2,1-2H3,(H,17,19) |
| InChIKey | CGNDIFDFWOFDBS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |