C22H19FN2O2 — CID 87498074
N-(1-ethynylcyclohexyl)-2-fluoro-9-oxo-10H-acridine-3-carboxamide (PubChem CID 87498074) has the molecular formula C22H19FN2O2 and a molecular weight of 362.40 g/mol. Its IUPAC name is N-(1-ethynylcyclohexyl)-2-fluoro-9-oxo-10H-acridine-3-carboxamide.
| Compound Name | N-(1-ethynylcyclohexyl)-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
|---|---|
| PubChem CID | 87498074 |
| Molecular Formula | C22H19FN2O2 |
| Molecular Weight | 362.40 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-(1-ethynylcyclohexyl)-2-fluoro-9-oxo-10H-acridine-3-carboxamide |
| SMILES | C#CC1(NC(=O)c2cc3[nH]c4ccccc4c(=O)c3cc2F)CCCCC1 |
| InChI | InChI=1S/C22H19FN2O2/c1-2-22(10-6-3-7-11-22)25-21(27)15-13-19-16(12-17(15)23)20(26)14-8-4-5-9-18(14)24-19/h1,4-5,8-9,12-13H,3,6-7,10-11H2,(H,24,26)(H,25,27) |
| InChIKey | YEISCYJGRFDNPR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 61.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.40 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|