C18H14N2O2 — CID 72892217
4-(1,3-dihydroisoindole-2-carbonyl)-1H-quinolin-2-one (PubChem CID 72892217) has the molecular formula C18H14N2O2 and a molecular weight of 290.32 g/mol. Its IUPAC name is 4-(1,3-dihydroisoindole-2-carbonyl)-1H-quinolin-2-one.
| Compound Name | 4-(1,3-dihydroisoindole-2-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 72892217 |
| Molecular Formula | C18H14N2O2 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-(1,3-dihydroisoindole-2-carbonyl)-1H-quinolin-2-one |
| SMILES | O=C(c1cc(=O)[nH]c2ccccc12)N1Cc2ccccc2C1 |
| InChI | InChI=1S/C18H14N2O2/c21-17-9-15(14-7-3-4-8-16(14)19-17)18(22)20-10-12-5-1-2-6-13(12)11-20/h1-9H,10-11H2,(H,19,21) |
| InChIKey | LNDYCFGMUHWRQG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 53.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |