C16H20N3O2+ — CID 2394404
4-(4-ethylpiperazin-4-ium-1-carbonyl)-1H-quinolin-2-one (PubChem CID 2394404) has the molecular formula C16H20N3O2+ and a molecular weight of 286.35 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-4-ium-1-carbonyl)-1H-quinolin-2-one.
| Compound Name | 4-(4-ethylpiperazin-4-ium-1-carbonyl)-1H-quinolin-2-one |
|---|---|
| PubChem CID | 2394404 |
| Molecular Formula | C16H20N3O2+ |
| Molecular Weight | 286.35 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 4-(4-ethylpiperazin-4-ium-1-carbonyl)-1H-quinolin-2-one |
| SMILES | CC[NH+]1CCN(C(=O)c2cc(=O)[nH]c3ccccc23)CC1 |
| InChI | InChI=1S/C16H19N3O2/c1-2-18-7-9-19(10-8-18)16(21)13-11-15(20)17-14-6-4-3-5-12(13)14/h3-6,11H,2,7-10H2,1H3,(H,17,20)/p+1 |
| InChIKey | LXMSYGTWPACENX-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.35 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |