About 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one
4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 167441155) has the molecular formula C24H25Cl2N3O2
and a molecular weight of 458.39 g/mol. Its IUPAC name is 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one.
Molecular Properties
| Compound Name | 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one |
| PubChem CID | 167441155 |
| Molecular Formula | C24H25Cl2N3O2 |
| Molecular Weight | 458.39 g/mol |
| Exact Mass | 457.13 |
| IUPAC Name | 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | CCCCC1CN(C(=O)c2cc(=O)[nH]c3ccccc23)CCN1c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C24H25Cl2N3O2/c1-2-3-6-17-15-28(11-12-29(17)16-9-10-20(25)21(26)13-16)24(31)19-14-23(30)27-22-8-5-4-7-18(19)22/h4-5,7-10,13-14,17H,2-3,6,11-12,15H2,1H3,(H,27,30) |
| InChIKey | PLMUGCTZSOPDRS-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.39 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one?
The IUPAC name of 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one (CID 167441155) is 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one.
What is the SMILES notation for 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one?
The canonical SMILES for 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one is CCCCC1CN(C(=O)c2cc(=O)[nH]c3ccccc23)CCN1c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one?
The InChIKey is PLMUGCTZSOPDRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H25Cl2N3O2/c1-2-3-6-17-15-28(11-12-29(17)16-9-10-20(25)21(26)13-16)24(31)19-14-23(30)27-22-8-5-4-7-18(19)22/h4-5,7-10,13-14,17H,2-3,6,11-12,15H2,1H3,(H,27,30).
What are the key properties of 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one?
4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one has a molecular weight of 458.39 g/mol, XLogP of 5.36, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-butyl-4-(3,4-dichlorophenyl)piperazine-1-carbonyl]-1H-quinolin-2-one is sourced from PubChem (CID 167441155), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).