C20H17Cl2N3O4S — CID 26870155
4-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-1H-quinolin-2-one (PubChem CID 26870155) has the molecular formula C20H17Cl2N3O4S and a molecular weight of 466.35 g/mol. Its IUPAC name is 4-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-1H-quinolin-2-one.
| Compound Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-1H-quinolin-2-one |
|---|---|
| PubChem CID | 26870155 |
| Molecular Formula | C20H17Cl2N3O4S |
| Molecular Weight | 466.35 g/mol |
| Exact Mass | 465.03 |
| IUPAC Name | 4-[4-(2,5-dichlorophenyl)sulfonylpiperazine-1-carbonyl]-1H-quinolin-2-one |
| SMILES | O=C(c1cc(=O)[nH]c2ccccc12)N1CCN(S(=O)(=O)c2cc(Cl)ccc2Cl)CC1 |
| InChI | InChI=1S/C20H17Cl2N3O4S/c21-13-5-6-16(22)18(11-13)30(28,29)25-9-7-24(8-10-25)20(27)15-12-19(26)23-17-4-2-1-3-14(15)17/h1-6,11-12H,7-10H2,(H,23,26) |
| InChIKey | WHPHMWFMHBOREN-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 90.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.35 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |