C32H42N4O3 — CID 155210909
[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]-[2-(1-methylpiperidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone (PubChem CID 155210909) has the molecular formula C32H42N4O3 and a molecular weight of 530.71 g/mol. Its IUPAC name is [2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]-[2-(1-methylpiperidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone.
| Compound Name | [2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]-[2-(1-methylpiperidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
|---|---|
| PubChem CID | 155210909 |
| Molecular Formula | C32H42N4O3 |
| Molecular Weight | 530.71 g/mol |
| Exact Mass | 530.33 |
| IUPAC Name | [2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]-[2-(1-methylpiperidin-4-yl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]methanone |
| SMILES | COc1ccc(-c2[nH]c3ccc(C(=O)N4CC5CN(C6CCN(C)CC6)CC5C4)cc3c2C(C)C)cc1OC |
| InChI | InChI=1S/C32H42N4O3/c1-20(2)30-26-14-22(6-8-27(26)33-31(30)21-7-9-28(38-4)29(15-21)39-5)32(37)36-18-23-16-35(17-24(23)19-36)25-10-12-34(3)13-11-25/h6-9,14-15,20,23-25,33H,10-13,16-19H2,1-5H3 |
| InChIKey | ZSBVANAWNYDZOD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.71 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |