C21H30F3NO6 — CID 127021275
(3R,3aR,6aS)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 127021275) has the molecular formula C21H30F3NO6 and a molecular weight of 449.47 g/mol. Its IUPAC name is (3R,3aR,6aS)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aR,6aS)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021275 |
| Molecular Formula | C21H30F3NO6 |
| Molecular Weight | 449.47 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (3R,3aR,6aS)-1-[(4,5-dimethylfuran-2-yl)methyl]-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | Cc1cc(CN2C[C@H](OCC3CCOCC3)[C@H]3COC[C@H]32)oc1C.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29NO4.C2HF3O2/c1-13-7-16(24-14(13)2)8-20-9-19(17-11-22-12-18(17)20)23-10-15-3-5-21-6-4-15;3-2(4,5)1(6)7/h7,15,17-19H,3-6,8-12H2,1-2H3;(H,6,7)/t17-,18+,19-;/m0./s1 |
| InChIKey | OMBRLPGAWAPJDX-FQTISCLSSA-N |
| XLogP | 3.17 |
| TPSA | 81.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.47 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |