C17H25NO4 — CID 125196271
(3R,3aS,6aR)-1-(furan-2-ylmethyl)-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole (PubChem CID 125196271) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is (3R,3aS,6aR)-1-(furan-2-ylmethyl)-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole.
| Compound Name | (3R,3aS,6aR)-1-(furan-2-ylmethyl)-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
|---|---|
| PubChem CID | 125196271 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | (3R,3aS,6aR)-1-(furan-2-ylmethyl)-3-(oxan-4-ylmethoxy)-2,3,3a,4,6,6a-hexahydrofuro[3,4-b]pyrrole |
| SMILES | c1coc(CN2C[C@H](OCC3CCOCC3)[C@@H]3COC[C@@H]32)c1 |
| InChI | InChI=1S/C17H25NO4/c1-2-14(21-5-1)8-18-9-17(15-11-20-12-16(15)18)22-10-13-3-6-19-7-4-13/h1-2,5,13,15-17H,3-4,6-12H2/t15-,16+,17+/m1/s1 |
| InChIKey | KKKYAQOUIGPKRY-IKGGRYGDSA-N |
| XLogP | 1.92 |
| TPSA | 44.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |