C15H20F3NO5 — CID 155854697
(3S,3aS,7aR)-1-(furan-2-ylmethyl)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155854697) has the molecular formula C15H20F3NO5 and a molecular weight of 351.32 g/mol. Its IUPAC name is (3S,3aS,7aR)-1-(furan-2-ylmethyl)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aS,7aR)-1-(furan-2-ylmethyl)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155854697 |
| Molecular Formula | C15H20F3NO5 |
| Molecular Weight | 351.32 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | (3S,3aS,7aR)-1-(furan-2-ylmethyl)-3-methoxy-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@H]1CN(Cc2ccco2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C13H19NO3.C2HF3O2/c1-15-12-9-14(8-10-4-2-6-16-10)11-5-3-7-17-13(11)12;3-2(4,5)1(6)7/h2,4,6,11-13H,3,5,7-9H2,1H3;(H,6,7)/t11-,12+,13+;/m1./s1 |
| InChIKey | BRJUWYKSAGBRGI-UQGASIHSSA-N |
| XLogP | 2.29 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.32 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |