C22H30F6N2O7 — CID 155846872
(4S,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-1-(oxan-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155846872) has the molecular formula C22H30F6N2O7 and a molecular weight of 548.48 g/mol. Its IUPAC name is (4S,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-1-(oxan-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4S,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-1-(oxan-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155846872 |
| Molecular Formula | C22H30F6N2O7 |
| Molecular Weight | 548.48 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | (4S,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-1-(oxan-4-yl)-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | CO[C@H]1CCN(C2CCOCC2)[C@@H]2CN(Cc3ccco3)C[C@H]12.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H28N2O3.2C2HF3O2/c1-21-18-4-7-20(14-5-9-22-10-6-14)17-13-19(12-16(17)18)11-15-3-2-8-23-15;2*3-2(4,5)1(6)7/h2-3,8,14,16-18H,4-7,9-13H2,1H3;2*(H,6,7)/t16-,17+,18-;;/m0../s1 |
| InChIKey | IUKDENRGBCBSSD-VWRRVXQQSA-N |
| XLogP | 3.25 |
| TPSA | 112.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.48 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |