C17H26F3N3O6S — CID 155833838
(4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-N,N-dimethyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155833838) has the molecular formula C17H26F3N3O6S and a molecular weight of 457.47 g/mol. Its IUPAC name is (4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-N,N-dimethyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-N,N-dimethyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155833838 |
| Molecular Formula | C17H26F3N3O6S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (4R,4aS,7aS)-6-(furan-2-ylmethyl)-4-methoxy-N,N-dimethyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine-1-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CO[C@@H]1CCN(S(=O)(=O)N(C)C)[C@@H]2CN(Cc3ccco3)C[C@@H]21.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H25N3O4S.C2HF3O2/c1-16(2)23(19,20)18-7-6-15(21-3)13-10-17(11-14(13)18)9-12-5-4-8-22-12;3-2(4,5)1(6)7/h4-5,8,13-15H,6-7,9-11H2,1-3H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | LIXFTCJDUUIZDA-ONAKXNSWSA-N |
| XLogP | 1.24 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |