C17H24F3N3O5S — CID 171694472
(4R,4aS,7aS)-6-ethyl-4-methoxy-1-pyridin-3-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;2,2,2-trifluoroacetic acid (PubChem CID 171694472) has the molecular formula C17H24F3N3O5S and a molecular weight of 439.46 g/mol. Its IUPAC name is (4R,4aS,7aS)-6-ethyl-4-methoxy-1-pyridin-3-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;2,2,2-trifluoroacetic acid.
| Compound Name | (4R,4aS,7aS)-6-ethyl-4-methoxy-1-pyridin-3-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171694472 |
| Molecular Formula | C17H24F3N3O5S |
| Molecular Weight | 439.46 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | (4R,4aS,7aS)-6-ethyl-4-methoxy-1-pyridin-3-ylsulfonyl-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine;2,2,2-trifluoroacetic acid |
| SMILES | CCN1C[C@H]2[C@@H](C1)N(S(=O)(=O)c1cccnc1)CC[C@H]2OC.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H23N3O3S.C2HF3O2/c1-3-17-10-13-14(11-17)18(8-6-15(13)21-2)22(19,20)12-5-4-7-16-9-12;3-2(4,5)1(6)7/h4-5,7,9,13-15H,3,6,8,10-11H2,1-2H3;(H,6,7)/t13-,14+,15+;/m0./s1 |
| InChIKey | AHBLGYBNXWQPCC-ONAKXNSWSA-N |
| XLogP | 1.44 |
| TPSA | 100.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.46 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |