C17H21FN4O2 — CID 97423278
(4S,4aS,7aS)-1-(5-fluoropyrimidin-2-yl)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine (PubChem CID 97423278) has the molecular formula C17H21FN4O2 and a molecular weight of 332.38 g/mol. Its IUPAC name is (4S,4aS,7aS)-1-(5-fluoropyrimidin-2-yl)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine.
| Compound Name | (4S,4aS,7aS)-1-(5-fluoropyrimidin-2-yl)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
|---|---|
| PubChem CID | 97423278 |
| Molecular Formula | C17H21FN4O2 |
| Molecular Weight | 332.38 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | (4S,4aS,7aS)-1-(5-fluoropyrimidin-2-yl)-6-(furan-2-ylmethyl)-4-methoxy-3,4,4a,5,7,7a-hexahydro-2H-pyrrolo[3,4-b]pyridine |
| SMILES | CO[C@H]1CCN(c2ncc(F)cn2)[C@@H]2CN(Cc3ccco3)C[C@H]12 |
| InChI | InChI=1S/C17H21FN4O2/c1-23-16-4-5-22(17-19-7-12(18)8-20-17)15-11-21(10-14(15)16)9-13-3-2-6-24-13/h2-3,6-8,14-16H,4-5,9-11H2,1H3/t14-,15+,16-/m0/s1 |
| InChIKey | MJFBJVBAFBKINA-XHSDSOJGSA-N |
| XLogP | 1.93 |
| TPSA | 54.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.38 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |