C20H26F4N2O5 — CID 127021737
2-[[(3S,3aS,7aR)-1-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 127021737) has the molecular formula C20H26F4N2O5 and a molecular weight of 450.43 g/mol. Its IUPAC name is 2-[[(3S,3aS,7aR)-1-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(3S,3aS,7aR)-1-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 127021737 |
| Molecular Formula | C20H26F4N2O5 |
| Molecular Weight | 450.43 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 2-[[(3S,3aS,7aR)-1-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CO[C@H]1CN(Cc2cccc(F)c2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C18H25FN2O3.C2HF3O2/c1-20(2)17(22)12-24-16-11-21(15-7-4-8-23-18(15)16)10-13-5-3-6-14(19)9-13;3-2(4,5)1(6)7/h3,5-6,9,15-16,18H,4,7-8,10-12H2,1-2H3;(H,6,7)/t15-,16+,18+;/m1./s1 |
| InChIKey | CUJOPUAFJZFRHS-ILOWUWAQSA-N |
| XLogP | 2.30 |
| TPSA | 79.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |