C19H26F3N3O5 — CID 171696935
2-[[(4aS,7R,7aR)-4-(pyridin-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid (PubChem CID 171696935) has the molecular formula C19H26F3N3O5 and a molecular weight of 433.43 g/mol. Its IUPAC name is 2-[[(4aS,7R,7aR)-4-(pyridin-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[[(4aS,7R,7aR)-4-(pyridin-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 171696935 |
| Molecular Formula | C19H26F3N3O5 |
| Molecular Weight | 433.43 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | 2-[[(4aS,7R,7aR)-4-(pyridin-3-ylmethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazin-7-yl]oxy]-N,N-dimethylacetamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)CO[C@@H]1CC[C@H]2[C@H]1OCCN2Cc1cccnc1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H25N3O3.C2HF3O2/c1-19(2)16(21)12-23-15-6-5-14-17(15)22-9-8-20(14)11-13-4-3-7-18-10-13;3-2(4,5)1(6)7/h3-4,7,10,14-15,17H,5-6,8-9,11-12H2,1-2H3;(H,6,7)/t14-,15+,17+;/m0./s1 |
| InChIKey | DJQRRRIWBXMGII-FFMLRVAQSA-N |
| XLogP | 1.55 |
| TPSA | 92.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.43 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |