C19H25F4N3O4 — CID 155826901
(3R,3aS,7aR)-3-(dimethylamino)-N-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155826901) has the molecular formula C19H25F4N3O4 and a molecular weight of 435.42 g/mol. Its IUPAC name is (3R,3aS,7aR)-3-(dimethylamino)-N-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | (3R,3aS,7aR)-3-(dimethylamino)-N-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155826901 |
| Molecular Formula | C19H25F4N3O4 |
| Molecular Weight | 435.42 g/mol |
| Exact Mass | 435.18 |
| IUPAC Name | (3R,3aS,7aR)-3-(dimethylamino)-N-[(3-fluorophenyl)methyl]-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole-1-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)[C@@H]1CN(C(=O)NCc2cccc(F)c2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H24FN3O2.C2HF3O2/c1-20(2)15-11-21(14-7-4-8-23-16(14)15)17(22)19-10-12-5-3-6-13(18)9-12;3-2(4,5)1(6)7/h3,5-6,9,14-16H,4,7-8,10-11H2,1-2H3,(H,19,22);(H,6,7)/t14-,15-,16+;/m1./s1 |
| InChIKey | GNEQVRHBFIPNIO-IFKKJYDISA-N |
| XLogP | 2.46 |
| TPSA | 82.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |