C17H23FN2O3 — CID 134074411
N-[(3-fluorophenyl)methyl]-6-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide (PubChem CID 134074411) has the molecular formula C17H23FN2O3 and a molecular weight of 322.38 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-6-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide.
| Compound Name | N-[(3-fluorophenyl)methyl]-6-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide |
|---|---|
| PubChem CID | 134074411 |
| Molecular Formula | C17H23FN2O3 |
| Molecular Weight | 322.38 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-6-(methoxymethyl)-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine-4-carboxamide |
| SMILES | COCC1CC2OCCN(C(=O)NCc3cccc(F)c3)C2C1 |
| InChI | InChI=1S/C17H23FN2O3/c1-22-11-13-8-15-16(9-13)23-6-5-20(15)17(21)19-10-12-3-2-4-14(18)7-12/h2-4,7,13,15-16H,5-6,8-11H2,1H3,(H,19,21) |
| InChIKey | OCQBUFDDJGSOEJ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |