C19H23FN6O2 — CID 163319546
(3aS,6aS)-N-[(3-fluorophenyl)methyl]-1-[3-(1,2,4-triazol-4-yl)propanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide (PubChem CID 163319546) has the molecular formula C19H23FN6O2 and a molecular weight of 386.43 g/mol. Its IUPAC name is (3aS,6aS)-N-[(3-fluorophenyl)methyl]-1-[3-(1,2,4-triazol-4-yl)propanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide.
| Compound Name | (3aS,6aS)-N-[(3-fluorophenyl)methyl]-1-[3-(1,2,4-triazol-4-yl)propanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 163319546 |
| Molecular Formula | C19H23FN6O2 |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.19 |
| IUPAC Name | (3aS,6aS)-N-[(3-fluorophenyl)methyl]-1-[3-(1,2,4-triazol-4-yl)propanoyl]-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole-4-carboxamide |
| SMILES | O=C(CCn1cnnc1)N1CC[C@H]2[C@@H]1CCN2C(=O)NCc1cccc(F)c1 |
| InChI | InChI=1S/C19H23FN6O2/c20-15-3-1-2-14(10-15)11-21-19(28)26-9-5-16-17(26)4-8-25(16)18(27)6-7-24-12-22-23-13-24/h1-3,10,12-13,16-17H,4-9,11H2,(H,21,28)/t16-,17-/m0/s1 |
| InChIKey | MSHYGLKBBAXYQV-IRXDYDNUSA-N |
| XLogP | 1.39 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |