C18H23F3N2O4 — CID 155845560
(3S,3aS,7aR)-3-prop-2-enoxy-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid (PubChem CID 155845560) has the molecular formula C18H23F3N2O4 and a molecular weight of 388.39 g/mol. Its IUPAC name is (3S,3aS,7aR)-3-prop-2-enoxy-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid.
| Compound Name | (3S,3aS,7aR)-3-prop-2-enoxy-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155845560 |
| Molecular Formula | C18H23F3N2O4 |
| Molecular Weight | 388.39 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | (3S,3aS,7aR)-3-prop-2-enoxy-1-(pyridin-2-ylmethyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrole;2,2,2-trifluoroacetic acid |
| SMILES | C=CCO[C@H]1CN(Cc2ccccn2)[C@@H]2CCCO[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C16H22N2O2.C2HF3O2/c1-2-9-19-15-12-18(11-13-6-3-4-8-17-13)14-7-5-10-20-16(14)15;3-2(4,5)1(6)7/h2-4,6,8,14-16H,1,5,7,9-12H2;(H,6,7)/t14-,15+,16+;/m1./s1 |
| InChIKey | FBHXZEFIXNNZJA-BZSDZJHCSA-N |
| XLogP | 2.65 |
| TPSA | 71.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.39 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|