C19H24F6N2O6S — CID 155848519
(4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-prop-2-enyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) (PubChem CID 155848519) has the molecular formula C19H24F6N2O6S and a molecular weight of 522.46 g/mol. Its IUPAC name is (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-prop-2-enyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-prop-2-enyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 155848519 |
| Molecular Formula | C19H24F6N2O6S |
| Molecular Weight | 522.46 g/mol |
| Exact Mass | 522.13 |
| IUPAC Name | (4aS,7R,7aR)-7-[(2-methyl-1,3-thiazol-4-yl)methoxy]-4-prop-2-enyl-3,4a,5,6,7,7a-hexahydro-2H-cyclopenta[b][1,4]oxazine;bis(2,2,2-trifluoroacetic acid) |
| SMILES | C=CCN1CCO[C@H]2[C@H](OCc3csc(C)n3)CC[C@@H]21.O=C(O)C(F)(F)F.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C15H22N2O2S.2C2HF3O2/c1-3-6-17-7-8-18-15-13(17)4-5-14(15)19-9-12-10-20-11(2)16-12;2*3-2(4,5)1(6)7/h3,10,13-15H,1,4-9H2,2H3;2*(H,6,7)/t13-,14+,15+;;/m0../s1 |
| InChIKey | YSADGWJXIBWDMQ-ZFSDTUNKSA-N |
| XLogP | 3.65 |
| TPSA | 109.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.46 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|