C20H25N3O — CID 97474426
(3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-2-(pyridin-3-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole (PubChem CID 97474426) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is (3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-2-(pyridin-3-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole.
| Compound Name | (3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-2-(pyridin-3-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
|---|---|
| PubChem CID | 97474426 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | (3aS,6aS)-3a-(pyridin-4-ylmethoxymethyl)-2-(pyridin-3-ylmethyl)-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrole |
| SMILES | c1cncc(CN2C[C@H]3CCC[C@@]3(COCc3ccncc3)C2)c1 |
| InChI | InChI=1S/C20H25N3O/c1-4-19-13-23(12-18-3-2-8-22-11-18)15-20(19,7-1)16-24-14-17-5-9-21-10-6-17/h2-3,5-6,8-11,19H,1,4,7,12-16H2/t19-,20+/m1/s1 |
| InChIKey | BEIMRGDGEHUNEK-UXHICEINSA-N |
| XLogP | 3.30 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |