C20H25N3O2 — CID 124790929
(8S)-8-[2-(pyridin-4-ylmethoxy)ethyl]-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.4]octane (PubChem CID 124790929) has the molecular formula C20H25N3O2 and a molecular weight of 339.44 g/mol. Its IUPAC name is (8S)-8-[2-(pyridin-4-ylmethoxy)ethyl]-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.4]octane.
| Compound Name | (8S)-8-[2-(pyridin-4-ylmethoxy)ethyl]-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 124790929 |
| Molecular Formula | C20H25N3O2 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.19 |
| IUPAC Name | (8S)-8-[2-(pyridin-4-ylmethoxy)ethyl]-2-(pyridin-3-ylmethyl)-5-oxa-2-azaspiro[3.4]octane |
| SMILES | c1cncc(CN2CC3(C2)OCC[C@@H]3CCOCc2ccncc2)c1 |
| InChI | InChI=1S/C20H25N3O2/c1-2-18(12-22-7-1)13-23-15-20(16-23)19(6-11-25-20)5-10-24-14-17-3-8-21-9-4-17/h1-4,7-9,12,19H,5-6,10-11,13-16H2/t19-/m0/s1 |
| InChIKey | KXYGIWAKOHNHHZ-IBGZPJMESA-N |
| XLogP | 2.67 |
| TPSA | 47.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|