C20H28N2O3S — CID 124794370
[(8R)-8-[2-(pyridin-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-(thian-4-yl)methanone (PubChem CID 124794370) has the molecular formula C20H28N2O3S and a molecular weight of 376.52 g/mol. Its IUPAC name is [(8R)-8-[2-(pyridin-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-(thian-4-yl)methanone.
| Compound Name | [(8R)-8-[2-(pyridin-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-(thian-4-yl)methanone |
|---|---|
| PubChem CID | 124794370 |
| Molecular Formula | C20H28N2O3S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.18 |
| IUPAC Name | [(8R)-8-[2-(pyridin-4-ylmethoxy)ethyl]-5-oxa-2-azaspiro[3.4]octan-2-yl]-(thian-4-yl)methanone |
| SMILES | O=C(C1CCSCC1)N1CC2(C1)OCC[C@H]2CCOCc1ccncc1 |
| InChI | InChI=1S/C20H28N2O3S/c23-19(17-5-11-26-12-6-17)22-14-20(15-22)18(4-10-25-20)3-9-24-13-16-1-7-21-8-2-16/h1-2,7-8,17-18H,3-6,9-15H2/t18-/m1/s1 |
| InChIKey | RIPFWRZBWVJPFH-GOSISDBHSA-N |
| XLogP | 2.75 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|