C19H22F3N5O4S — CID 155830821
N-[[(3R,3aS,6aS)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 155830821) has the molecular formula C19H22F3N5O4S and a molecular weight of 473.48 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155830821 |
| Molecular Formula | C19H22F3N5O4S |
| Molecular Weight | 473.48 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-[(4-methyl-1,3-thiazol-5-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]pyrazine-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | Cc1ncsc1CN1C[C@@H]2[C@H](CNC(=O)c3cnccn3)CO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C17H21N5O2S.C2HF3O2/c1-11-16(25-10-21-11)8-22-6-13-12(9-24-15(13)7-22)4-20-17(23)14-5-18-2-3-19-14;3-2(4,5)1(6)7/h2-3,5,10,12-13,15H,4,6-9H2,1H3,(H,20,23);(H,6,7)/t12-,13-,15-;/m1./s1 |
| InChIKey | LTXYGROZIHWRPT-VJKSBRAMSA-N |
| XLogP | 1.75 |
| TPSA | 117.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.48 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |