C17H23N3OS2 — CID 97475501
(5aS,8aS)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine (PubChem CID 97475501) has the molecular formula C17H23N3OS2 and a molecular weight of 349.53 g/mol. Its IUPAC name is (5aS,8aS)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine.
| Compound Name | (5aS,8aS)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
|---|---|
| PubChem CID | 97475501 |
| Molecular Formula | C17H23N3OS2 |
| Molecular Weight | 349.53 g/mol |
| Exact Mass | 349.13 |
| IUPAC Name | (5aS,8aS)-7-[(4-methyl-1,3-thiazol-5-yl)methyl]-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine |
| SMILES | Cc1ncsc1CN1C[C@@H]2CN(Cc3ccsc3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C17H23N3OS2/c1-13-17(23-12-18-13)10-20-8-15-7-19(3-4-21-16(15)9-20)6-14-2-5-22-11-14/h2,5,11-12,15-16H,3-4,6-10H2,1H3/t15-,16+/m0/s1 |
| InChIKey | WPCNZUCJEIRZSI-JKSUJKDBSA-N |
| XLogP | 2.85 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.53 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |