C18H20F3N3O5S — CID 155841130
[(5aS,8aS)-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1,3-oxazol-4-yl)methanone;2,2,2-trifluoroacetic acid (PubChem CID 155841130) has the molecular formula C18H20F3N3O5S and a molecular weight of 447.44 g/mol. Its IUPAC name is [(5aS,8aS)-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1,3-oxazol-4-yl)methanone;2,2,2-trifluoroacetic acid.
| Compound Name | [(5aS,8aS)-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1,3-oxazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155841130 |
| Molecular Formula | C18H20F3N3O5S |
| Molecular Weight | 447.44 g/mol |
| Exact Mass | 447.11 |
| IUPAC Name | [(5aS,8aS)-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepin-7-yl]-(1,3-oxazol-4-yl)methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cocn1)N1C[C@@H]2CN(Cc3ccsc3)CCO[C@@H]2C1 |
| InChI | InChI=1S/C16H19N3O3S.C2HF3O2/c20-16(14-9-21-11-17-14)19-7-13-6-18(2-3-22-15(13)8-19)5-12-1-4-23-10-12;3-2(4,5)1(6)7/h1,4,9-11,13,15H,2-3,5-8H2;(H,6,7)/t13-,15+;/m0./s1 |
| InChIKey | BCVLXKSDDAIKCL-NQQJLSKUSA-N |
| XLogP | 2.34 |
| TPSA | 96.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.44 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |