C16H24F3N3O5S2 — CID 155847573
(5aS,8aS)-N,N-dimethyl-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-7-sulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155847573) has the molecular formula C16H24F3N3O5S2 and a molecular weight of 459.51 g/mol. Its IUPAC name is (5aS,8aS)-N,N-dimethyl-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-7-sulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | (5aS,8aS)-N,N-dimethyl-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-7-sulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155847573 |
| Molecular Formula | C16H24F3N3O5S2 |
| Molecular Weight | 459.51 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | (5aS,8aS)-N,N-dimethyl-4-(thiophen-3-ylmethyl)-3,5,5a,6,8,8a-hexahydro-2H-pyrrolo[3,4-f][1,4]oxazepine-7-sulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)S(=O)(=O)N1C[C@@H]2CN(Cc3ccsc3)CCO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H23N3O3S2.C2HF3O2/c1-15(2)22(18,19)17-9-13-8-16(4-5-20-14(13)10-17)7-12-3-6-21-11-12;3-2(4,5)1(6)7/h3,6,11,13-14H,4-5,7-10H2,1-2H3;(H,6,7)/t13-,14+;/m0./s1 |
| InChIKey | TVJDMVRRAAXCGU-LMRHVHIWSA-N |
| XLogP | 1.32 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.51 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |