C16H21F3N2O5S — CID 155853502
N-[[(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155853502) has the molecular formula C16H21F3N2O5S and a molecular weight of 410.41 g/mol. Its IUPAC name is N-[[(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155853502 |
| Molecular Formula | C16H21F3N2O5S |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[[(3R,3aS,6aS)-5-methyl-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | CN1C[C@@H]2[C@H](CNS(=O)(=O)c3ccccc3)CO[C@@H]2C1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C14H20N2O3S.C2HF3O2/c1-16-8-13-11(10-19-14(13)9-16)7-15-20(17,18)12-5-3-2-4-6-12;3-2(4,5)1(6)7/h2-6,11,13-15H,7-10H2,1H3;(H,6,7)/t11-,13-,14-;/m1./s1 |
| InChIKey | LADQZVAKLOVUFU-JUDVJHIWSA-N |
| XLogP | 1.17 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |