C21H30F3N3O5 — CID 155864519
3-[[(3R,3aS,6aS)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155864519) has the molecular formula C21H30F3N3O5 and a molecular weight of 461.48 g/mol. Its IUPAC name is 3-[[(3R,3aS,6aS)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3R,3aS,6aS)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155864519 |
| Molecular Formula | C21H30F3N3O5 |
| Molecular Weight | 461.48 g/mol |
| Exact Mass | 461.21 |
| IUPAC Name | 3-[[(3R,3aS,6aS)-5-(2-phenylmethoxyethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NC[C@@H]1CO[C@@H]2CN(CCOCc3ccccc3)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H29N3O3.C2HF3O2/c1-21(2)19(23)20-10-16-14-25-18-12-22(11-17(16)18)8-9-24-13-15-6-4-3-5-7-15;3-2(4,5)1(6)7/h3-7,16-18H,8-14H2,1-2H3,(H,20,23);(H,6,7)/t16-,17-,18-;/m1./s1 |
| InChIKey | HMAIPTLLPUWISO-IIUXMCBISA-N |
| XLogP | 2.05 |
| TPSA | 91.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|