C21H27F3N4O4 — CID 155834923
3-[[(3S,3aS,6aS)-5-(1H-indol-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid (PubChem CID 155834923) has the molecular formula C21H27F3N4O4 and a molecular weight of 456.47 g/mol. Its IUPAC name is 3-[[(3S,3aS,6aS)-5-(1H-indol-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[(3S,3aS,6aS)-5-(1H-indol-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155834923 |
| Molecular Formula | C21H27F3N4O4 |
| Molecular Weight | 456.47 g/mol |
| Exact Mass | 456.20 |
| IUPAC Name | 3-[[(3S,3aS,6aS)-5-(1H-indol-4-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]-1,1-dimethylurea;2,2,2-trifluoroacetic acid |
| SMILES | CN(C)C(=O)NC[C@H]1CO[C@@H]2CN(Cc3cccc4[nH]ccc34)C[C@H]12.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C19H26N4O2.C2HF3O2/c1-22(2)19(24)21-8-14-12-25-18-11-23(10-16(14)18)9-13-4-3-5-17-15(13)6-7-20-17;3-2(4,5)1(6)7/h3-7,14,16,18,20H,8-12H2,1-2H3,(H,21,24);(H,6,7)/t14-,16+,18+;/m0./s1 |
| InChIKey | GSHJMOMEANXURJ-QUQDROCISA-N |
| XLogP | 2.52 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.47 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |