C20H23F3N2O6S — CID 155856013
N-[[(3S,3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid (PubChem CID 155856013) has the molecular formula C20H23F3N2O6S and a molecular weight of 476.47 g/mol. Its IUPAC name is N-[[(3S,3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[[(3S,3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 155856013 |
| Molecular Formula | C20H23F3N2O6S |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 476.12 |
| IUPAC Name | N-[[(3S,3aS,6aS)-5-(furan-2-ylmethyl)-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=S(=O)(NC[C@H]1CO[C@@H]2CN(Cc3ccco3)C[C@H]12)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O4S.C2HF3O2/c21-25(22,16-6-2-1-3-7-16)19-9-14-13-24-18-12-20(11-17(14)18)10-15-5-4-8-23-15;3-2(4,5)1(6)7/h1-8,14,17-19H,9-13H2;(H,6,7)/t14-,17+,18+;/m0./s1 |
| InChIKey | MQXKRQFPQAWXER-QHADQLFXSA-N |
| XLogP | 2.34 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |