C18H23N3O4S — CID 124798009
N-[[(3S,3aR,6aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide (PubChem CID 124798009) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-[[(3S,3aR,6aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide.
| Compound Name | N-[[(3S,3aR,6aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 124798009 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-[[(3S,3aR,6aR)-5-[(5-methyl-1,2-oxazol-3-yl)methyl]-2,3,3a,4,6,6a-hexahydrofuro[2,3-c]pyrrol-3-yl]methyl]benzenesulfonamide |
| SMILES | Cc1cc(CN2C[C@H]3[C@@H](CNS(=O)(=O)c4ccccc4)CO[C@H]3C2)no1 |
| InChI | InChI=1S/C18H23N3O4S/c1-13-7-15(20-25-13)9-21-10-17-14(12-24-18(17)11-21)8-19-26(22,23)16-5-3-2-4-6-16/h2-7,14,17-19H,8-12H2,1H3/t14-,17-,18-/m0/s1 |
| InChIKey | KCCSNJXNVYJTGE-WBAXXEDZSA-N |
| XLogP | 1.41 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |