C19H28N2O3 — CID 124802231
(3S,4aS,8aR)-N-methyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 124802231) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3S,4aS,8aR)-N-methyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3S,4aS,8aR)-N-methyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124802231 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3S,4aS,8aR)-N-methyl-6-(2-phenylmethoxyethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1CO[C@@H]2CCN(CCOCc3ccccc3)C[C@@H]2C1 |
| InChI | InChI=1S/C19H28N2O3/c1-20-19(22)17-11-16-12-21(8-7-18(16)24-14-17)9-10-23-13-15-5-3-2-4-6-15/h2-6,16-18H,7-14H2,1H3,(H,20,22)/t16-,17-,18+/m0/s1 |
| InChIKey | NYKXMGSXIIOZNB-OKZBNKHCSA-N |
| XLogP | 1.68 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|