C20H27N3O2 — CID 124815692
(3S,4aS,8aR)-N-methyl-6-[(1-methylindol-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 124815692) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (3S,4aS,8aR)-N-methyl-6-[(1-methylindol-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3S,4aS,8aR)-N-methyl-6-[(1-methylindol-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 124815692 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (3S,4aS,8aR)-N-methyl-6-[(1-methylindol-3-yl)methyl]-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | CNC(=O)[C@@H]1CO[C@@H]2CCN(Cc3cn(C)c4ccccc34)C[C@@H]2C1 |
| InChI | InChI=1S/C20H27N3O2/c1-21-20(24)15-9-14-11-23(8-7-19(14)25-13-15)12-16-10-22(2)18-6-4-3-5-17(16)18/h3-6,10,14-15,19H,7-9,11-13H2,1-2H3,(H,21,24)/t14-,15-,19+/m0/s1 |
| InChIKey | GGLQRADUJKHFSG-YZVOILCLSA-N |
| XLogP | 2.15 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |