C20H30N2O3 — CID 97388380
(3R,4aR,8aS)-N-(2-methoxyethyl)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide (PubChem CID 97388380) has the molecular formula C20H30N2O3 and a molecular weight of 346.47 g/mol. Its IUPAC name is (3R,4aR,8aS)-N-(2-methoxyethyl)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide.
| Compound Name | (3R,4aR,8aS)-N-(2-methoxyethyl)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 97388380 |
| Molecular Formula | C20H30N2O3 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.23 |
| IUPAC Name | (3R,4aR,8aS)-N-(2-methoxyethyl)-6-(2-phenylethyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CO[C@H]2CCN(CCc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C20H30N2O3/c1-24-12-9-21-20(23)18-13-17-14-22(11-8-19(17)25-15-18)10-7-16-5-3-2-4-6-16/h2-6,17-19H,7-15H2,1H3,(H,21,23)/t17-,18-,19+/m1/s1 |
| InChIKey | PHRBGGIPGGHDJD-QRVBRYPASA-N |
| XLogP | 1.72 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|