C23H38N4O2 — CID 29257710
(2S,4R)-4-(benzylamino)-N-(2-methoxyethyl)-1-(1-propylpiperidin-4-yl)pyrrolidine-2-carboxamide (PubChem CID 29257710) has the molecular formula C23H38N4O2 and a molecular weight of 402.58 g/mol. Its IUPAC name is (2S,4R)-4-(benzylamino)-N-(2-methoxyethyl)-1-(1-propylpiperidin-4-yl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(benzylamino)-N-(2-methoxyethyl)-1-(1-propylpiperidin-4-yl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 29257710 |
| Molecular Formula | C23H38N4O2 |
| Molecular Weight | 402.58 g/mol |
| Exact Mass | 402.30 |
| IUPAC Name | (2S,4R)-4-(benzylamino)-N-(2-methoxyethyl)-1-(1-propylpiperidin-4-yl)pyrrolidine-2-carboxamide |
| SMILES | CCCN1CCC(N2C[C@H](NCc3ccccc3)C[C@H]2C(=O)NCCOC)CC1 |
| InChI | InChI=1S/C23H38N4O2/c1-3-12-26-13-9-21(10-14-26)27-18-20(25-17-19-7-5-4-6-8-19)16-22(27)23(28)24-11-15-29-2/h4-8,20-22,25H,3,9-18H2,1-2H3,(H,24,28)/t20-,22+/m1/s1 |
| InChIKey | CCEVFCNGTSSSIP-IRLDBZIGSA-N |
| XLogP | 1.86 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.58 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|