C28H32ClN3O3 — CID 45237170
(2S,4S)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(3-phenoxyphenyl)methylamino]pyrrolidine-2-carboxamide (PubChem CID 45237170) has the molecular formula C28H32ClN3O3 and a molecular weight of 494.04 g/mol. Its IUPAC name is (2S,4S)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(3-phenoxyphenyl)methylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(3-phenoxyphenyl)methylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45237170 |
| Molecular Formula | C28H32ClN3O3 |
| Molecular Weight | 494.04 g/mol |
| Exact Mass | 493.21 |
| IUPAC Name | (2S,4S)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(3-phenoxyphenyl)methylamino]pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](NCc2cccc(Oc3ccccc3)c2)CN1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H32ClN3O3/c1-34-15-14-30-28(33)27-17-24(20-32(27)19-21-10-12-23(29)13-11-21)31-18-22-6-5-9-26(16-22)35-25-7-3-2-4-8-25/h2-13,16,24,27,31H,14-15,17-20H2,1H3,(H,30,33)/t24-,27-/m0/s1 |
| InChIKey | MVUYFCUONUNOBT-IGKIAQTJSA-N |
| XLogP | 4.63 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.04 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|