C32H42N4O2 — CID 45204789
(2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxamide (PubChem CID 45204789) has the molecular formula C32H42N4O2 and a molecular weight of 514.71 g/mol. Its IUPAC name is (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45204789 |
| Molecular Formula | C32H42N4O2 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-[(4-phenylphenyl)methylamino]pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CN2C[C@@H](NCc3ccc(-c4ccccc4)cc3)C[C@H]2C(=O)NCCOC)cc1 |
| InChI | InChI=1S/C32H42N4O2/c1-4-35(5-2)30-17-13-26(14-18-30)23-36-24-29(21-31(36)32(37)33-19-20-38-3)34-22-25-11-15-28(16-12-25)27-9-7-6-8-10-27/h6-18,29,31,34H,4-5,19-24H2,1-3H3,(H,33,37)/t29-,31-/m0/s1 |
| InChIKey | KSTAPOLQUMHYSX-SMCANUKXSA-N |
| XLogP | 4.70 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|