C31H39N5O3 — CID 45247115
methyl 4-[[[(3S,5S)-1-[[4-(diethylamino)phenyl]methyl]-5-(pyridin-3-ylmethylcarbamoyl)pyrrolidin-3-yl]amino]methyl]benzoate (PubChem CID 45247115) has the molecular formula C31H39N5O3 and a molecular weight of 529.69 g/mol. Its IUPAC name is methyl 4-[[[(3S,5S)-1-[[4-(diethylamino)phenyl]methyl]-5-(pyridin-3-ylmethylcarbamoyl)pyrrolidin-3-yl]amino]methyl]benzoate.
| Compound Name | methyl 4-[[[(3S,5S)-1-[[4-(diethylamino)phenyl]methyl]-5-(pyridin-3-ylmethylcarbamoyl)pyrrolidin-3-yl]amino]methyl]benzoate |
|---|---|
| PubChem CID | 45247115 |
| Molecular Formula | C31H39N5O3 |
| Molecular Weight | 529.69 g/mol |
| Exact Mass | 529.31 |
| IUPAC Name | methyl 4-[[[(3S,5S)-1-[[4-(diethylamino)phenyl]methyl]-5-(pyridin-3-ylmethylcarbamoyl)pyrrolidin-3-yl]amino]methyl]benzoate |
| SMILES | CCN(CC)c1ccc(CN2C[C@@H](NCc3ccc(C(=O)OC)cc3)C[C@H]2C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C31H39N5O3/c1-4-35(5-2)28-14-10-24(11-15-28)21-36-22-27(33-19-23-8-12-26(13-9-23)31(38)39-3)17-29(36)30(37)34-20-25-7-6-16-32-18-25/h6-16,18,27,29,33H,4-5,17,19-22H2,1-3H3,(H,34,37)/t27-,29-/m0/s1 |
| InChIKey | NIQCSYHJXPCEPI-YTMVLYRLSA-N |
| XLogP | 3.76 |
| TPSA | 86.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.69 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|