C29H36ClN5O — CID 118756237
(2S,4S)-4-[(2-chlorophenyl)methylamino]-1-[[4-(diethylamino)phenyl]methyl]-N-(pyridin-3-ylmethyl)pyrrolidine-2-carboxamide (PubChem CID 118756237) has the molecular formula C29H36ClN5O and a molecular weight of 506.09 g/mol. Its IUPAC name is (2S,4S)-4-[(2-chlorophenyl)methylamino]-1-[[4-(diethylamino)phenyl]methyl]-N-(pyridin-3-ylmethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[(2-chlorophenyl)methylamino]-1-[[4-(diethylamino)phenyl]methyl]-N-(pyridin-3-ylmethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118756237 |
| Molecular Formula | C29H36ClN5O |
| Molecular Weight | 506.09 g/mol |
| Exact Mass | 505.26 |
| IUPAC Name | (2S,4S)-4-[(2-chlorophenyl)methylamino]-1-[[4-(diethylamino)phenyl]methyl]-N-(pyridin-3-ylmethyl)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CN2C[C@@H](NCc3ccccc3Cl)C[C@H]2C(=O)NCc2cccnc2)cc1 |
| InChI | InChI=1S/C29H36ClN5O/c1-3-34(4-2)26-13-11-22(12-14-26)20-35-21-25(32-19-24-9-5-6-10-27(24)30)16-28(35)29(36)33-18-23-8-7-15-31-17-23/h5-15,17,25,28,32H,3-4,16,18-21H2,1-2H3,(H,33,36)/t25-,28-/m0/s1 |
| InChIKey | FWBDQPKXANUOSD-LSYYVWMOSA-N |
| XLogP | 4.63 |
| TPSA | 60.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.09 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|