C30H40N4O2 — CID 118755177
(2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-(naphthalen-1-ylmethylamino)pyrrolidine-2-carboxamide (PubChem CID 118755177) has the molecular formula C30H40N4O2 and a molecular weight of 488.68 g/mol. Its IUPAC name is (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-(naphthalen-1-ylmethylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-(naphthalen-1-ylmethylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118755177 |
| Molecular Formula | C30H40N4O2 |
| Molecular Weight | 488.68 g/mol |
| Exact Mass | 488.32 |
| IUPAC Name | (2S,4S)-1-[[4-(diethylamino)phenyl]methyl]-N-(2-methoxyethyl)-4-(naphthalen-1-ylmethylamino)pyrrolidine-2-carboxamide |
| SMILES | CCN(CC)c1ccc(CN2C[C@@H](NCc3cccc4ccccc34)C[C@H]2C(=O)NCCOC)cc1 |
| InChI | InChI=1S/C30H40N4O2/c1-4-33(5-2)27-15-13-23(14-16-27)21-34-22-26(19-29(34)30(35)31-17-18-36-3)32-20-25-11-8-10-24-9-6-7-12-28(24)25/h6-16,26,29,32H,4-5,17-22H2,1-3H3,(H,31,35)/t26-,29-/m0/s1 |
| InChIKey | BHAJULKXHPRHBG-WNJJXGMVSA-N |
| XLogP | 4.18 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|