C24H32ClN3O3 — CID 126467521
(2S,4R)-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(4-methoxy-3-methylphenyl)methylamino]pyrrolidine-2-carboxamide (PubChem CID 126467521) has the molecular formula C24H32ClN3O3 and a molecular weight of 445.99 g/mol. Its IUPAC name is (2S,4R)-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(4-methoxy-3-methylphenyl)methylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(4-methoxy-3-methylphenyl)methylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126467521 |
| Molecular Formula | C24H32ClN3O3 |
| Molecular Weight | 445.99 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | (2S,4R)-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[(4-methoxy-3-methylphenyl)methylamino]pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H](NCc2ccc(OC)c(C)c2)CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C24H32ClN3O3/c1-17-12-18(8-9-23(17)31-3)14-27-20-13-22(24(29)26-10-11-30-2)28(16-20)15-19-6-4-5-7-21(19)25/h4-9,12,20,22,27H,10-11,13-16H2,1-3H3,(H,26,29)/t20-,22+/m1/s1 |
| InChIKey | PUBNSOGJIDHSIR-IRLDBZIGSA-N |
| XLogP | 3.15 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.99 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|