C15H22ClN3O2 — CID 118759681
(2S,4S)-4-amino-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 118759681) has the molecular formula C15H22ClN3O2 and a molecular weight of 311.81 g/mol. Its IUPAC name is (2S,4S)-4-amino-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-amino-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118759681 |
| Molecular Formula | C15H22ClN3O2 |
| Molecular Weight | 311.81 g/mol |
| Exact Mass | 311.14 |
| IUPAC Name | (2S,4S)-4-amino-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](N)CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClN3O2/c1-21-7-6-18-15(20)14-8-12(17)10-19(14)9-11-4-2-3-5-13(11)16/h2-5,12,14H,6-10,17H2,1H3,(H,18,20)/t12-,14-/m0/s1 |
| InChIKey | VITDWDXVJFIGBQ-JSGCOSHPSA-N |
| XLogP | 1.00 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.81 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|