C27H37ClN4O2 — CID 45243303
(2S,4S)-4-[(1-benzylpiperidin-4-yl)amino]-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 45243303) has the molecular formula C27H37ClN4O2 and a molecular weight of 485.07 g/mol. Its IUPAC name is (2S,4S)-4-[(1-benzylpiperidin-4-yl)amino]-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-[(1-benzylpiperidin-4-yl)amino]-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45243303 |
| Molecular Formula | C27H37ClN4O2 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | (2S,4S)-4-[(1-benzylpiperidin-4-yl)amino]-1-[(2-chlorophenyl)methyl]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](NC2CCN(Cc3ccccc3)CC2)CN1Cc1ccccc1Cl |
| InChI | InChI=1S/C27H37ClN4O2/c1-34-16-13-29-27(33)26-17-24(20-32(26)19-22-9-5-6-10-25(22)28)30-23-11-14-31(15-12-23)18-21-7-3-2-4-8-21/h2-10,23-24,26,30H,11-20H2,1H3,(H,29,33)/t24-,26-/m0/s1 |
| InChIKey | XUAPVKGJHQYFKV-AHWVRZQESA-N |
| XLogP | 3.30 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|