C22H26ClF2N3O2 — CID 45210239
(2S,4R)-1-[(3-chlorophenyl)methyl]-4-[(3,4-difluorophenyl)methylamino]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide (PubChem CID 45210239) has the molecular formula C22H26ClF2N3O2 and a molecular weight of 437.92 g/mol. Its IUPAC name is (2S,4R)-1-[(3-chlorophenyl)methyl]-4-[(3,4-difluorophenyl)methylamino]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(3-chlorophenyl)methyl]-4-[(3,4-difluorophenyl)methylamino]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45210239 |
| Molecular Formula | C22H26ClF2N3O2 |
| Molecular Weight | 437.92 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | (2S,4R)-1-[(3-chlorophenyl)methyl]-4-[(3,4-difluorophenyl)methylamino]-N-(2-methoxyethyl)pyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@@H](NCc2ccc(F)c(F)c2)CN1Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H26ClF2N3O2/c1-30-8-7-26-22(29)21-11-18(27-12-15-5-6-19(24)20(25)10-15)14-28(21)13-16-3-2-4-17(23)9-16/h2-6,9-10,18,21,27H,7-8,11-14H2,1H3,(H,26,29)/t18-,21+/m1/s1 |
| InChIKey | YHMHMHZXKLLDRN-NQIIRXRSSA-N |
| XLogP | 3.11 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.92 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|