C20H30ClN3O2 — CID 91940276
(2S,4R)-1-[(3-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-(2-methylbut-2-enylamino)pyrrolidine-2-carboxamide (PubChem CID 91940276) has the molecular formula C20H30ClN3O2 and a molecular weight of 379.93 g/mol. Its IUPAC name is (2S,4R)-1-[(3-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-(2-methylbut-2-enylamino)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(3-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-(2-methylbut-2-enylamino)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 91940276 |
| Molecular Formula | C20H30ClN3O2 |
| Molecular Weight | 379.93 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | (2S,4R)-1-[(3-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-(2-methylbut-2-enylamino)pyrrolidine-2-carboxamide |
| SMILES | CC=C(C)CN[C@@H]1C[C@@H](C(=O)NCCOC)N(Cc2cccc(Cl)c2)C1 |
| InChI | InChI=1S/C20H30ClN3O2/c1-4-15(2)12-23-18-11-19(20(25)22-8-9-26-3)24(14-18)13-16-6-5-7-17(21)10-16/h4-7,10,18-19,23H,8-9,11-14H2,1-3H3,(H,22,25)/t18-,19+/m1/s1 |
| InChIKey | FSQVNRFGBKZMRD-MOPGFXCFSA-N |
| XLogP | 2.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.93 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|