C25H36ClN3O2 — CID 126465594
(2S,4R)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]pyrrolidine-2-carboxamide (PubChem CID 126465594) has the molecular formula C25H36ClN3O2 and a molecular weight of 446.04 g/mol. Its IUPAC name is (2S,4R)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 126465594 |
| Molecular Formula | C25H36ClN3O2 |
| Molecular Weight | 446.04 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | (2S,4R)-1-[(4-chlorophenyl)methyl]-N-(2-methoxyethyl)-4-[[(4S)-4-prop-1-en-2-ylcyclohexen-1-yl]methylamino]pyrrolidine-2-carboxamide |
| SMILES | C=C(C)[C@@H]1CC=C(CN[C@@H]2C[C@@H](C(=O)NCCOC)N(Cc3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C25H36ClN3O2/c1-18(2)21-8-4-19(5-9-21)15-28-23-14-24(25(30)27-12-13-31-3)29(17-23)16-20-6-10-22(26)11-7-20/h4,6-7,10-11,21,23-24,28H,1,5,8-9,12-17H2,2-3H3,(H,27,30)/t21-,23-,24+/m1/s1 |
| InChIKey | ZCYHJVMRVHSWSO-JRFVFWCSSA-N |
| XLogP | 3.94 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.04 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|