C18H29N3O2 — CID 45222870
(2S,4S)-4-(benzylamino)-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 45222870) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is (2S,4S)-4-(benzylamino)-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4S)-4-(benzylamino)-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45222870 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | (2S,4S)-4-(benzylamino)-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1C[C@H](NCc2ccccc2)CN1C(C)C |
| InChI | InChI=1S/C18H29N3O2/c1-14(2)21-13-16(20-12-15-7-5-4-6-8-15)11-17(21)18(22)19-9-10-23-3/h4-8,14,16-17,20H,9-13H2,1-3H3,(H,19,22)/t16-,17-/m0/s1 |
| InChIKey | OIKGCPMQCIKIFD-IRXDYDNUSA-N |
| XLogP | 1.39 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|