C26H36N4O2 — CID 45251340
(2S,4R)-4-[(9-ethylcarbazol-3-yl)methylamino]-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide (PubChem CID 45251340) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (2S,4R)-4-[(9-ethylcarbazol-3-yl)methylamino]-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-[(9-ethylcarbazol-3-yl)methylamino]-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 45251340 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (2S,4R)-4-[(9-ethylcarbazol-3-yl)methylamino]-N-(2-methoxyethyl)-1-propan-2-ylpyrrolidine-2-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(CN[C@@H]3C[C@@H](C(=O)NCCOC)N(C(C)C)C3)ccc21 |
| InChI | InChI=1S/C26H36N4O2/c1-5-29-23-9-7-6-8-21(23)22-14-19(10-11-24(22)29)16-28-20-15-25(30(17-20)18(2)3)26(31)27-12-13-32-4/h6-11,14,18,20,25,28H,5,12-13,15-17H2,1-4H3,(H,27,31)/t20-,25+/m1/s1 |
| InChIKey | GMIJNUDJMOYNFJ-NLFFAJNJSA-N |
| XLogP | 3.52 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|